C14H22O2 — CID 11074980
4-methoxy-2,3-dipropylcyclohepta-2,4-dien-1-one (PubChem CID 11074980) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-methoxy-2,3-dipropylcyclohepta-2,4-dien-1-one.
| Compound Name | 4-methoxy-2,3-dipropylcyclohepta-2,4-dien-1-one |
|---|---|
| PubChem CID | 11074980 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 4-methoxy-2,3-dipropylcyclohepta-2,4-dien-1-one |
| SMILES | CCCC1=C(CCC)C(OC)=CCCC1=O |
| InChI | InChI=1S/C14H22O2/c1-4-7-11-12(8-5-2)14(16-3)10-6-9-13(11)15/h10H,4-9H2,1-3H3 |
| InChIKey | MUZJBARKBBKHMW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |