C9H16F3NO — CID 143211697
1,4-dimethylpiperidine;2,2,2-trifluoroacetaldehyde (PubChem CID 143211697) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;2,2,2-trifluoroacetaldehyde.
| Compound Name | 1,4-dimethylpiperidine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 143211697 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1,4-dimethylpiperidine;2,2,2-trifluoroacetaldehyde |
| SMILES | CC1CCN(C)CC1.O=CC(F)(F)F |
| InChI | InChI=1S/C7H15N.C2HF3O/c1-7-3-5-8(2)6-4-7;3-2(4,5)1-6/h7H,3-6H2,1-2H3;1H |
| InChIKey | PKPPNJKXTDSDOR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|