C10H17F2NO — CID 89355852
3-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropanal (PubChem CID 89355852) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropanal.
| Compound Name | 3-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 89355852 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H17F2NO/c1-9(2,8-14)7-13-5-3-10(11,12)4-6-13/h8H,3-7H2,1-2H3 |
| InChIKey | XXEVENRUQZBBQW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|