C23H22ClN5O2S — CID 143211801
N-[1-(2-chloro-4-formylphenyl)-3-[(E)-1-methyliminopent-2-en-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]acetamide (PubChem CID 143211801) has the molecular formula C23H22ClN5O2S and a molecular weight of 467.98 g/mol. Its IUPAC name is N-[1-(2-chloro-4-formylphenyl)-3-[(E)-1-methyliminopent-2-en-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]acetamide.
| Compound Name | N-[1-(2-chloro-4-formylphenyl)-3-[(E)-1-methyliminopent-2-en-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]acetamide |
|---|---|
| PubChem CID | 143211801 |
| Molecular Formula | C23H22ClN5O2S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[1-(2-chloro-4-formylphenyl)-3-[(E)-1-methyliminopent-2-en-2-yl]-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazol-7-yl]acetamide |
| SMILES | CC/C=C(\C=N\C)c1nn(-c2ccc(C=O)cc2Cl)c2c1CCc1nc(NC(C)=O)sc1-2 |
| InChI | InChI=1S/C23H22ClN5O2S/c1-4-5-15(11-25-3)20-16-7-8-18-22(32-23(27-18)26-13(2)31)21(16)29(28-20)19-9-6-14(12-30)10-17(19)24/h5-6,9-12H,4,7-8H2,1-3H3,(H,26,27,31)/b15-5+,25-11+ |
| InChIKey | VTWIQHUMYBALMO-ZXYIELBKSA-N |
| XLogP | 5.01 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|