C19H18N6O2S — CID 172940172
ethenyl (3Z)-7-acetamido-1-phenyl-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazole-3-carbohydrazonate (PubChem CID 172940172) has the molecular formula C19H18N6O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is ethenyl (3Z)-7-acetamido-1-phenyl-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazole-3-carbohydrazonate.
| Compound Name | ethenyl (3Z)-7-acetamido-1-phenyl-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazole-3-carbohydrazonate |
|---|---|
| PubChem CID | 172940172 |
| Molecular Formula | C19H18N6O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | ethenyl (3Z)-7-acetamido-1-phenyl-4,5-dihydropyrazolo[4,5-g][1,3]benzothiazole-3-carbohydrazonate |
| SMILES | C=CO/C(=N\N)c1nn(-c2ccccc2)c2c1CCc1nc(NC(C)=O)sc1-2 |
| InChI | InChI=1S/C19H18N6O2S/c1-3-27-18(23-20)15-13-9-10-14-17(28-19(22-14)21-11(2)26)16(13)25(24-15)12-7-5-4-6-8-12/h3-8H,1,9-10,20H2,2H3,(H,21,22,26)/b23-18- |
| InChIKey | VHOIAJDTHHMWIJ-NKFKGCMQSA-N |
| XLogP | 2.83 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|