C11H12F3NO3S — CID 143214843
(2R,3S)-2,3-dihydroxy-4-[3-(trifluoromethyl)phenyl]sulfanylbutanamide (PubChem CID 143214843) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is (2R,3S)-2,3-dihydroxy-4-[3-(trifluoromethyl)phenyl]sulfanylbutanamide.
| Compound Name | (2R,3S)-2,3-dihydroxy-4-[3-(trifluoromethyl)phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 143214843 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (2R,3S)-2,3-dihydroxy-4-[3-(trifluoromethyl)phenyl]sulfanylbutanamide |
| SMILES | NC(=O)[C@H](O)[C@H](O)CSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO3S/c12-11(13,14)6-2-1-3-7(4-6)19-5-8(16)9(17)10(15)18/h1-4,8-9,16-17H,5H2,(H2,15,18)/t8-,9-/m1/s1 |
| InChIKey | OIZKZIYUDGMCQK-RKDXNWHRSA-N |
| XLogP | 1.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |