C12H10BrFO — CID 143215081
1-[(3E)-2-bromohexa-1,3,5-trien-3-yl]oxy-3-fluorobenzene (PubChem CID 143215081) has the molecular formula C12H10BrFO and a molecular weight of 269.11 g/mol. Its IUPAC name is 1-[(3E)-2-bromohexa-1,3,5-trien-3-yl]oxy-3-fluorobenzene.
| Compound Name | 1-[(3E)-2-bromohexa-1,3,5-trien-3-yl]oxy-3-fluorobenzene |
|---|---|
| PubChem CID | 143215081 |
| Molecular Formula | C12H10BrFO |
| Molecular Weight | 269.11 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 1-[(3E)-2-bromohexa-1,3,5-trien-3-yl]oxy-3-fluorobenzene |
| SMILES | C=C/C=C(/Oc1cccc(F)c1)C(=C)Br |
| InChI | InChI=1S/C12H10BrFO/c1-3-5-12(9(2)13)15-11-7-4-6-10(14)8-11/h3-8H,1-2H2/b12-5+ |
| InChIKey | XJCZNNLOMTUAIV-LFYBBSHMSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.11 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|