C20H33NO — CID 143215225
1-cyclohepta-2,4,6-trien-1-yl-5-methyl-1-piperidin-3-ylheptan-1-ol (PubChem CID 143215225) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 1-cyclohepta-2,4,6-trien-1-yl-5-methyl-1-piperidin-3-ylheptan-1-ol.
| Compound Name | 1-cyclohepta-2,4,6-trien-1-yl-5-methyl-1-piperidin-3-ylheptan-1-ol |
|---|---|
| PubChem CID | 143215225 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 1-cyclohepta-2,4,6-trien-1-yl-5-methyl-1-piperidin-3-ylheptan-1-ol |
| SMILES | CCC(C)CCCC(O)(C1C=CC=CC=C1)C1CCCNC1 |
| InChI | InChI=1S/C20H33NO/c1-3-17(2)10-8-14-20(22,19-13-9-15-21-16-19)18-11-6-4-5-7-12-18/h4-7,11-12,17-19,21-22H,3,8-10,13-16H2,1-2H3 |
| InChIKey | YKFGIGZRJCRDTL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |