C18H29NO — CID 143215332
(8Z,10Z)-7-methylidene-6-piperidin-3-yldodeca-1,8,10-trien-6-ol (PubChem CID 143215332) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is (8Z,10Z)-7-methylidene-6-piperidin-3-yldodeca-1,8,10-trien-6-ol.
| Compound Name | (8Z,10Z)-7-methylidene-6-piperidin-3-yldodeca-1,8,10-trien-6-ol |
|---|---|
| PubChem CID | 143215332 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | (8Z,10Z)-7-methylidene-6-piperidin-3-yldodeca-1,8,10-trien-6-ol |
| SMILES | C=CCCCC(O)(C(=C)/C=C\C=C/C)C1CCCNC1 |
| InChI | InChI=1S/C18H29NO/c1-4-6-8-11-16(3)18(20,13-9-7-5-2)17-12-10-14-19-15-17/h4-6,8,11,17,19-20H,2-3,7,9-10,12-15H2,1H3/b6-4-,11-8- |
| InChIKey | LSEKGYVUMFWCSM-DGBPBKOVSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|