C11H6N4OS — CID 143216106
4-nitroso-2-pyridin-2-ylthieno[2,3-d]pyrimidine (PubChem CID 143216106) has the molecular formula C11H6N4OS and a molecular weight of 242.26 g/mol. Its IUPAC name is 4-nitroso-2-pyridin-2-ylthieno[2,3-d]pyrimidine.
| Compound Name | 4-nitroso-2-pyridin-2-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 143216106 |
| Molecular Formula | C11H6N4OS |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 4-nitroso-2-pyridin-2-ylthieno[2,3-d]pyrimidine |
| SMILES | O=Nc1nc(-c2ccccn2)nc2sccc12 |
| InChI | InChI=1S/C11H6N4OS/c16-15-9-7-4-6-17-11(7)14-10(13-9)8-3-1-2-5-12-8/h1-6H |
| InChIKey | YZZDTPPZVJHZKH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |