About (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane
(3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane (PubChem CID 143216155) has the molecular formula C19H33BrO5S
and a molecular weight of 453.44 g/mol. Its IUPAC name is (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane.
Molecular Properties
| Compound Name | (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane |
| PubChem CID | 143216155 |
| Molecular Formula | C19H33BrO5S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane |
| SMILES | CC.CCCCCCCCOc1c(Br)cc(COS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C17H27BrO5S.C2H6/c1-4-5-6-7-8-9-10-22-17-15(18)11-14(12-16(17)21-2)13-23-24(3,19)20;1-2/h11-12H,4-10,13H2,1-3H3;1-2H3 |
| InChIKey | KOHBVOXWNSPYCS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane?
The IUPAC name of (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane (CID 143216155) is (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane.
What is the SMILES notation for (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane?
The canonical SMILES for (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane is CC.CCCCCCCCOc1c(Br)cc(COS(C)(=O)=O)cc1OC.
What is the InChIKey of (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane?
The InChIKey is KOHBVOXWNSPYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27BrO5S.C2H6/c1-4-5-6-7-8-9-10-22-17-15(18)11-14(12-16(17)21-2)13-23-24(3,19)20;1-2/h11-12H,4-10,13H2,1-3H3;1-2H3.
What are the key properties of (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane?
(3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane has a molecular weight of 453.44 g/mol, XLogP of 5.70, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-5-methoxy-4-octoxyphenyl)methyl methanesulfonate;ethane is sourced from PubChem (CID 143216155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).