C21H28N2O3 — CID 143216768
[4-(furan-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-methylpyrrolidine (PubChem CID 143216768) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is [4-(furan-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-methylpyrrolidine.
| Compound Name | [4-(furan-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-methylpyrrolidine |
|---|---|
| PubChem CID | 143216768 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [4-(furan-2-ylmethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-methylpyrrolidine |
| SMILES | CN1CCCC1.O=C(c1ccc(OCc2ccco2)cc1)N1CCCC1 |
| InChI | InChI=1S/C16H17NO3.C5H11N/c18-16(17-9-1-2-10-17)13-5-7-14(8-6-13)20-12-15-4-3-11-19-15;1-6-4-2-3-5-6/h3-8,11H,1-2,9-10,12H2;2-5H2,1H3 |
| InChIKey | TZQSZINRPJIVEV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |