C13H13NO — CID 143217388
2-cyclohepta-1,4,6-trien-1-yloxy-3-methylpyridine (PubChem CID 143217388) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-cyclohepta-1,4,6-trien-1-yloxy-3-methylpyridine.
| Compound Name | 2-cyclohepta-1,4,6-trien-1-yloxy-3-methylpyridine |
|---|---|
| PubChem CID | 143217388 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-cyclohepta-1,4,6-trien-1-yloxy-3-methylpyridine |
| SMILES | Cc1cccnc1OC1=CCC=CC=C1 |
| InChI | InChI=1S/C13H13NO/c1-11-7-6-10-14-13(11)15-12-8-4-2-3-5-9-12/h2-4,6-10H,5H2,1H3 |
| InChIKey | HBWHLBIDCZGCIC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |