C16H15N3O3 — CID 143217846
4-[4-(3-methoxyphenyl)-4,5-dihydrotriazol-1-yl]benzoic acid (PubChem CID 143217846) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[4-(3-methoxyphenyl)-4,5-dihydrotriazol-1-yl]benzoic acid.
| Compound Name | 4-[4-(3-methoxyphenyl)-4,5-dihydrotriazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 143217846 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-[4-(3-methoxyphenyl)-4,5-dihydrotriazol-1-yl]benzoic acid |
| SMILES | COc1cccc(C2CN(c3ccc(C(=O)O)cc3)N=N2)c1 |
| InChI | InChI=1S/C16H15N3O3/c1-22-14-4-2-3-12(9-14)15-10-19(18-17-15)13-7-5-11(6-8-13)16(20)21/h2-9,15H,10H2,1H3,(H,20,21) |
| InChIKey | RIUIEDSABVAEFV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |