C18H18F5N3 — CID 143218071
6-(6,7-difluorocyclohepta-1,3,6-trien-1-yl)-3-[1-(trifluoromethyl)cyclopropyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 143218071) has the molecular formula C18H18F5N3 and a molecular weight of 371.35 g/mol. Its IUPAC name is 6-(6,7-difluorocyclohepta-1,3,6-trien-1-yl)-3-[1-(trifluoromethyl)cyclopropyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 6-(6,7-difluorocyclohepta-1,3,6-trien-1-yl)-3-[1-(trifluoromethyl)cyclopropyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 143218071 |
| Molecular Formula | C18H18F5N3 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 6-(6,7-difluorocyclohepta-1,3,6-trien-1-yl)-3-[1-(trifluoromethyl)cyclopropyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | FC1=C(F)C(C2CCCc3nnc(C4(C(F)(F)F)CC4)n3C2)=CC=CC1 |
| InChI | InChI=1S/C18H18F5N3/c19-13-6-2-1-5-12(15(13)20)11-4-3-7-14-24-25-16(26(14)10-11)17(8-9-17)18(21,22)23/h1-2,5,11H,3-4,6-10H2 |
| InChIKey | ZNLUMSILRZWUFX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |