C18H20F5N3 — CID 143218193
6-[(1Z,4Z)-6,8-difluorocycloocta-1,4,7-trien-1-yl]-3-(3,3,3-trifluoropropyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 143218193) has the molecular formula C18H20F5N3 and a molecular weight of 373.37 g/mol. Its IUPAC name is 6-[(1Z,4Z)-6,8-difluorocycloocta-1,4,7-trien-1-yl]-3-(3,3,3-trifluoropropyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 6-[(1Z,4Z)-6,8-difluorocycloocta-1,4,7-trien-1-yl]-3-(3,3,3-trifluoropropyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 143218193 |
| Molecular Formula | C18H20F5N3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 6-[(1Z,4Z)-6,8-difluorocycloocta-1,4,7-trien-1-yl]-3-(3,3,3-trifluoropropyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | FC1=CC(F)/C=C\C/C=C\1C1CCCc2nnc(CCC(F)(F)F)n2C1 |
| InChI | InChI=1S/C18H20F5N3/c19-13-5-1-2-6-14(15(20)10-13)12-4-3-7-16-24-25-17(26(16)11-12)8-9-18(21,22)23/h1,5-6,10,12-13H,2-4,7-9,11H2/b5-1-,14-6-,15-10? |
| InChIKey | ZFJWNSLCSJVEHX-XTRKSVCXSA-N |
| XLogP | 4.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|