C16H18F5N3 — CID 143218172
(6S,9R)-6-(2,3-difluorophenyl)-3-(2,2,2-trifluoroethyl)-5,6,7,8,9,9a-hexahydro-1H-imidazo[1,2-a]azepin-9-amine (PubChem CID 143218172) has the molecular formula C16H18F5N3 and a molecular weight of 347.33 g/mol. Its IUPAC name is (6S,9R)-6-(2,3-difluorophenyl)-3-(2,2,2-trifluoroethyl)-5,6,7,8,9,9a-hexahydro-1H-imidazo[1,2-a]azepin-9-amine.
| Compound Name | (6S,9R)-6-(2,3-difluorophenyl)-3-(2,2,2-trifluoroethyl)-5,6,7,8,9,9a-hexahydro-1H-imidazo[1,2-a]azepin-9-amine |
|---|---|
| PubChem CID | 143218172 |
| Molecular Formula | C16H18F5N3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (6S,9R)-6-(2,3-difluorophenyl)-3-(2,2,2-trifluoroethyl)-5,6,7,8,9,9a-hexahydro-1H-imidazo[1,2-a]azepin-9-amine |
| SMILES | N[C@@H]1CC[C@@H](c2cccc(F)c2F)CN2C(CC(F)(F)F)=CNC12 |
| InChI | InChI=1S/C16H18F5N3/c17-12-3-1-2-11(14(12)18)9-4-5-13(22)15-23-7-10(24(15)8-9)6-16(19,20)21/h1-3,7,9,13,15,23H,4-6,8,22H2/t9-,13-,15?/m1/s1 |
| InChIKey | JBHJLSYAIPKNMS-BMMFJKPISA-N |
| XLogP | 3.19 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |