C18H26F2N2O — CID 166990396
(2R)-2-[[4-(2,3-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine (PubChem CID 166990396) has the molecular formula C18H26F2N2O and a molecular weight of 324.42 g/mol. Its IUPAC name is (2R)-2-[[4-(2,3-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine.
| Compound Name | (2R)-2-[[4-(2,3-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine |
|---|---|
| PubChem CID | 166990396 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2R)-2-[[4-(2,3-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine |
| SMILES | NC1CCCN[C@H]1COC1CCC(c2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C18H26F2N2O/c19-15-4-1-3-14(18(15)20)12-6-8-13(9-7-12)23-11-17-16(21)5-2-10-22-17/h1,3-4,12-13,16-17,22H,2,5-11,21H2/t12?,13?,16?,17-/m0/s1 |
| InChIKey | ZLDKYHYNKKMUOX-AMCGCOJJSA-N |
| XLogP | 3.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |