C16H18N6 — CID 143218728
2-[(2Z,4Z)-hexa-2,4-dienyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 143218728) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[(2Z,4Z)-hexa-2,4-dienyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-[(2Z,4Z)-hexa-2,4-dienyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 143218728 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[(2Z,4Z)-hexa-2,4-dienyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C/C=C\C=C/Cc1nc(Nc2cc(C)[nH]n2)c2cccn2n1 |
| InChI | InChI=1S/C16H18N6/c1-3-4-5-6-9-14-17-16(13-8-7-10-22(13)21-14)18-15-11-12(2)19-20-15/h3-8,10-11H,9H2,1-2H3,(H2,17,18,19,20,21)/b4-3-,6-5- |
| InChIKey | FKZQEAFHOVSBGN-OUPQRBNQSA-N |
| XLogP | 3.18 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|