C18H18FN7O — CID 45107763
2-[(4-fluorophenyl)-(methoxyamino)methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 45107763) has the molecular formula C18H18FN7O and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)-(methoxyamino)methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-[(4-fluorophenyl)-(methoxyamino)methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 45107763 |
| Molecular Formula | C18H18FN7O |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[(4-fluorophenyl)-(methoxyamino)methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CONC(c1ccc(F)cc1)c1nc(Nc2cc(C)[nH]n2)c2cccn2n1 |
| InChI | InChI=1S/C18H18FN7O/c1-11-10-15(23-22-11)20-17-14-4-3-9-26(14)24-18(21-17)16(25-27-2)12-5-7-13(19)8-6-12/h3-10,16,25H,1-2H3,(H2,20,21,22,23,24) |
| InChIKey | ILGBWVWLKREYFG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|