C26H31N5O3 — CID 143218984
N-[1-(dimethylamino)ethylidene]-3-[2-methoxy-6-[3-(4-methoxyphenyl)propylamino]pyrimidin-4-yl]benzamide (PubChem CID 143218984) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[1-(dimethylamino)ethylidene]-3-[2-methoxy-6-[3-(4-methoxyphenyl)propylamino]pyrimidin-4-yl]benzamide.
| Compound Name | N-[1-(dimethylamino)ethylidene]-3-[2-methoxy-6-[3-(4-methoxyphenyl)propylamino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 143218984 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | N-[1-(dimethylamino)ethylidene]-3-[2-methoxy-6-[3-(4-methoxyphenyl)propylamino]pyrimidin-4-yl]benzamide |
| SMILES | COc1ccc(CCCNc2cc(-c3cccc(C(=O)/N=C(\C)N(C)C)c3)nc(OC)n2)cc1 |
| InChI | InChI=1S/C26H31N5O3/c1-18(31(2)3)28-25(32)21-10-6-9-20(16-21)23-17-24(30-26(29-23)34-5)27-15-7-8-19-11-13-22(33-4)14-12-19/h6,9-14,16-17H,7-8,15H2,1-5H3,(H,27,29,30)/b28-18+ |
| InChIKey | DNQLTKTZSXNGDB-MTDXEUNCSA-N |
| XLogP | 4.33 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|