C26H30N4O2 — CID 143652183
2-methoxy-N-[2-(4-methoxyphenyl)ethyl]-6-[3-[(E)-4-methyliminopent-2-en-2-yl]phenyl]pyrimidin-4-amine (PubChem CID 143652183) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-methoxy-N-[2-(4-methoxyphenyl)ethyl]-6-[3-[(E)-4-methyliminopent-2-en-2-yl]phenyl]pyrimidin-4-amine.
| Compound Name | 2-methoxy-N-[2-(4-methoxyphenyl)ethyl]-6-[3-[(E)-4-methyliminopent-2-en-2-yl]phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143652183 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-methoxy-N-[2-(4-methoxyphenyl)ethyl]-6-[3-[(E)-4-methyliminopent-2-en-2-yl]phenyl]pyrimidin-4-amine |
| SMILES | C/N=C(C)/C=C(\C)c1cccc(-c2cc(NCCc3ccc(OC)cc3)nc(OC)n2)c1 |
| InChI | InChI=1S/C26H30N4O2/c1-18(15-19(2)27-3)21-7-6-8-22(16-21)24-17-25(30-26(29-24)32-5)28-14-13-20-9-11-23(31-4)12-10-20/h6-12,15-17H,13-14H2,1-5H3,(H,28,29,30)/b18-15+,27-19+ |
| InChIKey | AHPDETJFHXSNGD-CYVOIWCESA-N |
| XLogP | 5.31 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|