C20H18F3N3O2 — CID 141138699
2-methoxy-6-phenyl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine (PubChem CID 141138699) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 2-methoxy-6-phenyl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine.
| Compound Name | 2-methoxy-6-phenyl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 141138699 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-methoxy-6-phenyl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine |
| SMILES | COc1nc(NCCc2ccc(OC(F)(F)F)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H18F3N3O2/c1-27-19-25-17(15-5-3-2-4-6-15)13-18(26-19)24-12-11-14-7-9-16(10-8-14)28-20(21,22)23/h2-10,13H,11-12H2,1H3,(H,24,25,26) |
| InChIKey | LVTHQLUDGXBSFJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |