C20H17F4N3O — CID 141138716
N-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]-2-methoxy-6-phenylpyrimidin-4-amine (PubChem CID 141138716) has the molecular formula C20H17F4N3O and a molecular weight of 391.37 g/mol. Its IUPAC name is N-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]-2-methoxy-6-phenylpyrimidin-4-amine.
| Compound Name | N-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]-2-methoxy-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 141138716 |
| Molecular Formula | C20H17F4N3O |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]-2-methoxy-6-phenylpyrimidin-4-amine |
| SMILES | COc1nc(NCCc2ccc(C(F)(F)F)cc2F)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H17F4N3O/c1-28-19-26-17(14-5-3-2-4-6-14)12-18(27-19)25-10-9-13-7-8-15(11-16(13)21)20(22,23)24/h2-8,11-12H,9-10H2,1H3,(H,25,26,27) |
| InChIKey | FIJMHJKFMPPWNG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |