C20H21N3O3 — CID 135509970
2-[2-methoxy-6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]phenol (PubChem CID 135509970) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[2-methoxy-6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]phenol.
| Compound Name | 2-[2-methoxy-6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 135509970 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[2-methoxy-6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]phenol |
| SMILES | COc1ccc(CCNc2cc(-c3ccccc3O)nc(OC)n2)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-25-15-9-7-14(8-10-15)11-12-21-19-13-17(22-20(23-19)26-2)16-5-3-4-6-18(16)24/h3-10,13,24H,11-12H2,1-2H3,(H,21,22,23) |
| InChIKey | AAYUCSUEYKDIEG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |