C20H30O5 — CID 143221226
(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl 5-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)-3-oxopentanoate (PubChem CID 143221226) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl 5-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)-3-oxopentanoate.
| Compound Name | (6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl 5-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)-3-oxopentanoate |
|---|---|
| PubChem CID | 143221226 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl 5-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)-3-oxopentanoate |
| SMILES | CC12CCC(CCC(=O)CC(=O)OCC3CCC4(C)OC4C3)CC1O2 |
| InChI | InChI=1S/C20H30O5/c1-19-7-5-13(9-16(19)24-19)3-4-15(21)11-18(22)23-12-14-6-8-20(2)17(10-14)25-20/h13-14,16-17H,3-12H2,1-2H3 |
| InChIKey | LDVAWQWUSHITRM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|