C18H29NO4 — CID 89059492
6-methyl-N-[1-[(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methoxy]ethyl]-7-oxabicyclo[4.1.0]heptane-3-carboxamide (PubChem CID 89059492) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 6-methyl-N-[1-[(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methoxy]ethyl]-7-oxabicyclo[4.1.0]heptane-3-carboxamide.
| Compound Name | 6-methyl-N-[1-[(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methoxy]ethyl]-7-oxabicyclo[4.1.0]heptane-3-carboxamide |
|---|---|
| PubChem CID | 89059492 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 6-methyl-N-[1-[(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)methoxy]ethyl]-7-oxabicyclo[4.1.0]heptane-3-carboxamide |
| SMILES | CC(NC(=O)C1CCC2(C)OC2C1)OCC1CCC2(C)OC2C1 |
| InChI | InChI=1S/C18H29NO4/c1-11(21-10-12-4-6-17(2)14(8-12)22-17)19-16(20)13-5-7-18(3)15(9-13)23-18/h11-15H,4-10H2,1-3H3,(H,19,20) |
| InChIKey | GJBKMLUBXCWODN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|