C20H29N3O4S — CID 143222508
5-[2-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 143222508) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is 5-[2-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[2-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 143222508 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 5-[2-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | COCCOc1ccc(CCC2SC(N3CCN(C)CC3)=NC2=O)cc1OC |
| InChI | InChI=1S/C20H29N3O4S/c1-22-8-10-23(11-9-22)20-21-19(24)18(28-20)7-5-15-4-6-16(17(14-15)26-3)27-13-12-25-2/h4,6,14,18H,5,7-13H2,1-3H3 |
| InChIKey | PVTDGNAHCSUHLI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|