C21H28N4O5 — CID 30773941
2-(3,4-dimethoxyphenyl)-1-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]ethanone (PubChem CID 30773941) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 30773941 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]ethanone |
| SMILES | COCCOc1ccc(N2CCN(C(=O)Cc3ccc(OC)c(OC)c3)CC2)nn1 |
| InChI | InChI=1S/C21H28N4O5/c1-27-12-13-30-20-7-6-19(22-23-20)24-8-10-25(11-9-24)21(26)15-16-4-5-17(28-2)18(14-16)29-3/h4-7,14H,8-13,15H2,1-3H3 |
| InChIKey | NLPGOOIBTWWFDK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|