C21H28N4O3 — CID 30773954
1-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]-4-phenylbutan-1-one (PubChem CID 30773954) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 30773954 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]-4-phenylbutan-1-one |
| SMILES | COCCOc1ccc(N2CCN(C(=O)CCCc3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C21H28N4O3/c1-27-16-17-28-20-11-10-19(22-23-20)24-12-14-25(15-13-24)21(26)9-5-8-18-6-3-2-4-7-18/h2-4,6-7,10-11H,5,8-9,12-17H2,1H3 |
| InChIKey | SNMOPJHLGGESPX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|