C18H21BrN4O3 — CID 30773889
(3-bromophenyl)-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 30773889) has the molecular formula C18H21BrN4O3 and a molecular weight of 421.30 g/mol. Its IUPAC name is (3-bromophenyl)-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 30773889 |
| Molecular Formula | C18H21BrN4O3 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (3-bromophenyl)-[4-[6-(2-methoxyethoxy)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | COCCOc1ccc(N2CCN(C(=O)c3cccc(Br)c3)CC2)nn1 |
| InChI | InChI=1S/C18H21BrN4O3/c1-25-11-12-26-17-6-5-16(20-21-17)22-7-9-23(10-8-22)18(24)14-3-2-4-15(19)13-14/h2-6,13H,7-12H2,1H3 |
| InChIKey | OGOCCRWZIRQRNP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|