About (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne
(Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne (PubChem CID 143222920) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne.
Molecular Properties
| Compound Name | (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne |
| PubChem CID | 143222920 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne |
| SMILES | C#CC.C/C=C\C.C=C1Cc2ccccc2N1CCO |
| InChI | InChI=1S/C11H13NO.C4H8.C3H4/c1-9-8-10-4-2-3-5-11(10)12(9)6-7-13;1-3-4-2;1-3-2/h2-5,13H,1,6-8H2;3-4H,1-2H3;1H,2H3/b;4-3-; |
| InChIKey | DVPVHDVVJWSKSB-LWFKIUJUSA-N |
| XLogP | 3.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne?
The IUPAC name of (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne (CID 143222920) is (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne.
What is the SMILES notation for (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne?
The canonical SMILES for (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne is C#CC.C/C=C\C.C=C1Cc2ccccc2N1CCO.
What is the InChIKey of (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne?
The InChIKey is DVPVHDVVJWSKSB-LWFKIUJUSA-N. The full InChI is InChI=1S/C11H13NO.C4H8.C3H4/c1-9-8-10-4-2-3-5-11(10)12(9)6-7-13;1-3-4-2;1-3-2/h2-5,13H,1,6-8H2;3-4H,1-2H3;1H,2H3/b;4-3-;.
What are the key properties of (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne?
(Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne has a molecular weight of 271.40 g/mol, XLogP of 3.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;2-(2-methylidene-3H-indol-1-yl)ethanol;prop-1-yne is sourced from PubChem (CID 143222920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).