C22H15BrN5OP — CID 143223308
5-(4-bromophenyl)-6-(2-phosphanylphenyl)-1-pyridin-2-ylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 143223308) has the molecular formula C22H15BrN5OP and a molecular weight of 476.27 g/mol. Its IUPAC name is 5-(4-bromophenyl)-6-(2-phosphanylphenyl)-1-pyridin-2-ylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-(4-bromophenyl)-6-(2-phosphanylphenyl)-1-pyridin-2-ylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 143223308 |
| Molecular Formula | C22H15BrN5OP |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 5-(4-bromophenyl)-6-(2-phosphanylphenyl)-1-pyridin-2-ylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cnn(-c3ccccn3)c2nc(-c2ccccc2P)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H15BrN5OP/c23-14-8-10-15(11-9-14)27-20(16-5-1-2-6-18(16)30)26-21-17(22(27)29)13-25-28(21)19-7-3-4-12-24-19/h1-13H,30H2 |
| InChIKey | KXWZMCYBRNVUEJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|