C17H36N4O4 — CID 143224699
tert-butyl N-[N'-(4-aminobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate;ethane (PubChem CID 143224699) has the molecular formula C17H36N4O4 and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl N-[N'-(4-aminobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate;ethane.
| Compound Name | tert-butyl N-[N'-(4-aminobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate;ethane |
|---|---|
| PubChem CID | 143224699 |
| Molecular Formula | C17H36N4O4 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | tert-butyl N-[N'-(4-aminobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC(=NCCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N4O4.C2H6/c1-14(2,3)22-12(20)18-11(17-10-8-7-9-16)19-13(21)23-15(4,5)6;1-2/h7-10,16H2,1-6H3,(H2,17,18,19,20,21);1-2H3 |
| InChIKey | QKMIJAWEWVVUOA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|