C17H34O — CID 143227384
4-(8-methoxyoctyl)-1,2-dimethylcyclohexane (PubChem CID 143227384) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is 4-(8-methoxyoctyl)-1,2-dimethylcyclohexane.
| Compound Name | 4-(8-methoxyoctyl)-1,2-dimethylcyclohexane |
|---|---|
| PubChem CID | 143227384 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 4-(8-methoxyoctyl)-1,2-dimethylcyclohexane |
| SMILES | COCCCCCCCCC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C17H34O/c1-15-11-12-17(14-16(15)2)10-8-6-4-5-7-9-13-18-3/h15-17H,4-14H2,1-3H3 |
| InChIKey | SWOGYVITRPWGBP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|