C13H26O — CID 126691015
5-(3,4-dimethylcyclohexyl)pentan-1-ol (PubChem CID 126691015) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 5-(3,4-dimethylcyclohexyl)pentan-1-ol.
| Compound Name | 5-(3,4-dimethylcyclohexyl)pentan-1-ol |
|---|---|
| PubChem CID | 126691015 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 5-(3,4-dimethylcyclohexyl)pentan-1-ol |
| SMILES | CC1CCC(CCCCCO)CC1C |
| InChI | InChI=1S/C13H26O/c1-11-7-8-13(10-12(11)2)6-4-3-5-9-14/h11-14H,3-10H2,1-2H3 |
| InChIKey | XVMOPALCGYEFJE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|