About 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane
4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane (PubChem CID 143243624) has the molecular formula C27H52
and a molecular weight of 376.71 g/mol. Its IUPAC name is 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane.
Molecular Properties
| Compound Name | 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane |
| PubChem CID | 143243624 |
| Molecular Formula | C27H52 |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 376.41 |
| IUPAC Name | 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane |
| SMILES | C=C(CCCCCCCCCC1CCC(C)C(C)C1)C(CC)CCC(C)C |
| InChI | InChI=1S/C27H52/c1-7-27(20-17-22(2)3)24(5)15-13-11-9-8-10-12-14-16-26-19-18-23(4)25(6)21-26/h22-23,25-27H,5,7-21H2,1-4,6H3 |
| InChIKey | HRRYICDEWIXNBK-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane?
The IUPAC name of 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane (CID 143243624) is 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane.
What is the SMILES notation for 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane?
The canonical SMILES for 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane is C=C(CCCCCCCCCC1CCC(C)C(C)C1)C(CC)CCC(C)C.
What is the InChIKey of 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane?
The InChIKey is HRRYICDEWIXNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H52/c1-7-27(20-17-22(2)3)24(5)15-13-11-9-8-10-12-14-16-26-19-18-23(4)25(6)21-26/h22-23,25-27H,5,7-21H2,1-4,6H3.
What are the key properties of 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane?
4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane has a molecular weight of 376.71 g/mol, XLogP of 9.59, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(11-ethyl-14-methyl-10-methylidenepentadecyl)-1,2-dimethylcyclohexane is sourced from PubChem (CID 143243624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).