C28H48 — CID 123196429
9,10-dimethylidene-2,6-bis(4-methylpentyl)-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene (PubChem CID 123196429) has the molecular formula C28H48 and a molecular weight of 384.69 g/mol. Its IUPAC name is 9,10-dimethylidene-2,6-bis(4-methylpentyl)-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene.
| Compound Name | 9,10-dimethylidene-2,6-bis(4-methylpentyl)-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene |
|---|---|
| PubChem CID | 123196429 |
| Molecular Formula | C28H48 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.38 |
| IUPAC Name | 9,10-dimethylidene-2,6-bis(4-methylpentyl)-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene |
| SMILES | C=C1C2CCC(CCCC(C)C)CC2C(=C)C2CCC(CCCC(C)C)CC12 |
| InChI | InChI=1S/C28H48/c1-19(2)9-7-11-23-13-15-25-22(6)28-18-24(12-8-10-20(3)4)14-16-26(28)21(5)27(25)17-23/h19-20,23-28H,5-18H2,1-4H3 |
| InChIKey | WMMLDJUJDDQTNV-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|