C21H38O4 — CID 144537537
dimethyl (1R)-4-(4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate (PubChem CID 144537537) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is dimethyl (1R)-4-(4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate.
| Compound Name | dimethyl (1R)-4-(4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 144537537 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | dimethyl (1R)-4-(4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC(CCCC(C)CCCC(C)C)CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C21H38O4/c1-15(2)8-6-9-16(3)10-7-11-17-12-13-18(20(22)24-4)19(14-17)21(23)25-5/h15-19H,6-14H2,1-5H3/t16?,17?,18-,19?/m1/s1 |
| InChIKey | VAUWHNHFSWOLLK-YKPIGIGISA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |