C40H76O6 — CID 71042372
bis(2-methoxyethyl) 5-(4,8-dimethylnonyl)-3-(3,7,11-trimethyldodecyl)cyclohexane-1,2-dicarboxylate (PubChem CID 71042372) has the molecular formula C40H76O6 and a molecular weight of 653.04 g/mol. Its IUPAC name is bis(2-methoxyethyl) 5-(4,8-dimethylnonyl)-3-(3,7,11-trimethyldodecyl)cyclohexane-1,2-dicarboxylate.
| Compound Name | bis(2-methoxyethyl) 5-(4,8-dimethylnonyl)-3-(3,7,11-trimethyldodecyl)cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71042372 |
| Molecular Formula | C40H76O6 |
| Molecular Weight | 653.04 g/mol |
| Exact Mass | 652.56 |
| IUPAC Name | bis(2-methoxyethyl) 5-(4,8-dimethylnonyl)-3-(3,7,11-trimethyldodecyl)cyclohexane-1,2-dicarboxylate |
| SMILES | COCCOC(=O)C1CC(CCCC(C)CCCC(C)C)CC(CCC(C)CCCC(C)CCCC(C)C)C1C(=O)OCCOC |
| InChI | InChI=1S/C40H76O6/c1-30(2)14-10-16-32(5)18-12-19-34(7)22-23-36-28-35(21-13-20-33(6)17-11-15-31(3)4)29-37(39(41)45-26-24-43-8)38(36)40(42)46-27-25-44-9/h30-38H,10-29H2,1-9H3 |
| InChIKey | KCWMNEGJNRYLOD-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.04 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|