C28H56O — CID 70946686
trans-(1S,2R)-1-(2-propoxyethyl)-2-[(7R,11R)-3,7,11,15-tetramethylhexadecyl]cyclopropane (PubChem CID 70946686) has the molecular formula C28H56O and a molecular weight of 408.76 g/mol. Its IUPAC name is trans-(1S,2R)-1-(2-propoxyethyl)-2-[(7R,11R)-3,7,11,15-tetramethylhexadecyl]cyclopropane.
| Compound Name | trans-(1S,2R)-1-(2-propoxyethyl)-2-[(7R,11R)-3,7,11,15-tetramethylhexadecyl]cyclopropane |
|---|---|
| PubChem CID | 70946686 |
| Molecular Formula | C28H56O |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 408.43 |
| IUPAC Name | trans-(1S,2R)-1-(2-propoxyethyl)-2-[(7R,11R)-3,7,11,15-tetramethylhexadecyl]cyclopropane |
| SMILES | CCCOCC[C@@H]1C[C@H]1CCC(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C28H56O/c1-7-20-29-21-19-28-22-27(28)18-17-26(6)16-10-15-25(5)14-9-13-24(4)12-8-11-23(2)3/h23-28H,7-22H2,1-6H3/t24-,25-,26?,27-,28-/m1/s1 |
| InChIKey | GNOBMUXSEAECBJ-AQDGZUPLSA-N |
| XLogP | 9.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|