C20H36N2O2 — CID 123266037
4-(4,8-dimethylnonyl)-1-N-methylidenecyclohexane-1,2-dicarboxamide (PubChem CID 123266037) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 4-(4,8-dimethylnonyl)-1-N-methylidenecyclohexane-1,2-dicarboxamide.
| Compound Name | 4-(4,8-dimethylnonyl)-1-N-methylidenecyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 123266037 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 4-(4,8-dimethylnonyl)-1-N-methylidenecyclohexane-1,2-dicarboxamide |
| SMILES | C=NC(=O)C1CCC(CCCC(C)CCCC(C)C)CC1C(N)=O |
| InChI | InChI=1S/C20H36N2O2/c1-14(2)7-5-8-15(3)9-6-10-16-11-12-17(20(24)22-4)18(13-16)19(21)23/h14-18H,4-13H2,1-3H3,(H2,21,23) |
| InChIKey | LJVRMBFSVKMSCL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|