C21H37ClO4 — CID 71042142
dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate (PubChem CID 71042142) has the molecular formula C21H37ClO4 and a molecular weight of 388.98 g/mol. Its IUPAC name is dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71042142 |
| Molecular Formula | C21H37ClO4 |
| Molecular Weight | 388.98 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate |
| SMILES | COC(=O)C1CCC(CCCC(C)(Cl)CCCC(C)C)CC1C(=O)OC |
| InChI | InChI=1S/C21H37ClO4/c1-15(2)8-6-12-21(3,22)13-7-9-16-10-11-17(19(23)25-4)18(14-16)20(24)26-5/h15-18H,6-14H2,1-5H3 |
| InChIKey | WURBXMVQLZTSQZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.98 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|