About dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate
dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate (PubChem CID 71042142) has the molecular formula C21H37ClO4
and a molecular weight of 388.98 g/mol. Its IUPAC name is dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate |
| PubChem CID | 71042142 |
| Molecular Formula | C21H37ClO4 |
| Molecular Weight | 388.98 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate |
| SMILES | COC(=O)C1CCC(CCCC(C)(Cl)CCCC(C)C)CC1C(=O)OC |
| InChI | InChI=1S/C21H37ClO4/c1-15(2)8-6-12-21(3,22)13-7-9-16-10-11-17(19(23)25-4)18(14-16)20(24)26-5/h15-18H,6-14H2,1-5H3 |
| InChIKey | WURBXMVQLZTSQZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.98 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate?
The IUPAC name of dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate (CID 71042142) is dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate?
The canonical SMILES for dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate is COC(=O)C1CCC(CCCC(C)(Cl)CCCC(C)C)CC1C(=O)OC.
What is the InChIKey of dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate?
The InChIKey is WURBXMVQLZTSQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37ClO4/c1-15(2)8-6-12-21(3,22)13-7-9-16-10-11-17(19(23)25-4)18(14-16)20(24)26-5/h15-18H,6-14H2,1-5H3.
What are the key properties of dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate?
dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate has a molecular weight of 388.98 g/mol, XLogP of 5.36, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-(4-chloro-4,8-dimethylnonyl)cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 71042142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).