C27H52O5 — CID 123762820
2-[2-(2-ethoxyethoxy)ethoxy]ethyl 2-[3-(4,8-dimethylnonyl)cyclohexyl]acetate (PubChem CID 123762820) has the molecular formula C27H52O5 and a molecular weight of 456.71 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 2-[3-(4,8-dimethylnonyl)cyclohexyl]acetate.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 2-[3-(4,8-dimethylnonyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 123762820 |
| Molecular Formula | C27H52O5 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 2-[3-(4,8-dimethylnonyl)cyclohexyl]acetate |
| SMILES | CCOCCOCCOCCOC(=O)CC1CCCC(CCCC(C)CCCC(C)C)C1 |
| InChI | InChI=1S/C27H52O5/c1-5-29-15-16-30-17-18-31-19-20-32-27(28)22-26-14-8-13-25(21-26)12-7-11-24(4)10-6-9-23(2)3/h23-26H,5-22H2,1-4H3 |
| InChIKey | UODICGYNRVEJGV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|