About 4-methylpentyl 2-piperidin-4-ylacetate
4-methylpentyl 2-piperidin-4-ylacetate (PubChem CID 79608603) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-methylpentyl 2-piperidin-4-ylacetate.
Molecular Properties
| Compound Name | 4-methylpentyl 2-piperidin-4-ylacetate |
| PubChem CID | 79608603 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 4-methylpentyl 2-piperidin-4-ylacetate |
| SMILES | CC(C)CCCOC(=O)CC1CCNCC1 |
| InChI | InChI=1S/C13H25NO2/c1-11(2)4-3-9-16-13(15)10-12-5-7-14-8-6-12/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | PTZBREPZNQDOGN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentyl 2-piperidin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentyl 2-piperidin-4-ylacetate?
The IUPAC name of 4-methylpentyl 2-piperidin-4-ylacetate (CID 79608603) is 4-methylpentyl 2-piperidin-4-ylacetate.
What is the SMILES notation for 4-methylpentyl 2-piperidin-4-ylacetate?
The canonical SMILES for 4-methylpentyl 2-piperidin-4-ylacetate is CC(C)CCCOC(=O)CC1CCNCC1.
What is the InChIKey of 4-methylpentyl 2-piperidin-4-ylacetate?
The InChIKey is PTZBREPZNQDOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-11(2)4-3-9-16-13(15)10-12-5-7-14-8-6-12/h11-12,14H,3-10H2,1-2H3.
What are the key properties of 4-methylpentyl 2-piperidin-4-ylacetate?
4-methylpentyl 2-piperidin-4-ylacetate has a molecular weight of 227.35 g/mol, XLogP of 2.36, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentyl 2-piperidin-4-ylacetate is sourced from PubChem (CID 79608603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).