C33H60O6 — CID 156758333
4-methylpentyl 3-[3,4-bis[3-(4-methylpentoxy)-3-oxopropyl]cyclohexyl]propanoate (PubChem CID 156758333) has the molecular formula C33H60O6 and a molecular weight of 552.84 g/mol. Its IUPAC name is 4-methylpentyl 3-[3,4-bis[3-(4-methylpentoxy)-3-oxopropyl]cyclohexyl]propanoate.
| Compound Name | 4-methylpentyl 3-[3,4-bis[3-(4-methylpentoxy)-3-oxopropyl]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 156758333 |
| Molecular Formula | C33H60O6 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.44 |
| IUPAC Name | 4-methylpentyl 3-[3,4-bis[3-(4-methylpentoxy)-3-oxopropyl]cyclohexyl]propanoate |
| SMILES | CC(C)CCCOC(=O)CCC1CCC(CCC(=O)OCCCC(C)C)C(CCC(=O)OCCCC(C)C)C1 |
| InChI | InChI=1S/C33H60O6/c1-25(2)10-7-21-37-31(34)18-14-28-13-15-29(16-19-32(35)38-22-8-11-26(3)4)30(24-28)17-20-33(36)39-23-9-12-27(5)6/h25-30H,7-24H2,1-6H3 |
| InChIKey | JTFBCCYMRXGSMF-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|