C21H36O6 — CID 175134622
3-[3-(2-carboxyethyl)-4-[3-(4-methylpentoxy)-3-oxopropyl]cyclohexyl]propanoic acid (PubChem CID 175134622) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-[3-(2-carboxyethyl)-4-[3-(4-methylpentoxy)-3-oxopropyl]cyclohexyl]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethyl)-4-[3-(4-methylpentoxy)-3-oxopropyl]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 175134622 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 3-[3-(2-carboxyethyl)-4-[3-(4-methylpentoxy)-3-oxopropyl]cyclohexyl]propanoic acid |
| SMILES | CC(C)CCCOC(=O)CCC1CCC(CCC(=O)O)CC1CCC(=O)O |
| InChI | InChI=1S/C21H36O6/c1-15(2)4-3-13-27-21(26)12-9-17-7-5-16(6-10-19(22)23)14-18(17)8-11-20(24)25/h15-18H,3-14H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | DMHKRQURNWAIMN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|