C25H34N4O5 — CID 143229756
prop-2-ynyl N-[6-[(5R,6S)-2-(4-hydroxycyclohexyl)spiro[7-oxa-2-azabicyclo[4.1.0]heptane-5,3'-piperidine]-1'-yl]-5-methoxy-3-pyridinyl]carbamate (PubChem CID 143229756) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is prop-2-ynyl N-[6-[(5R,6S)-2-(4-hydroxycyclohexyl)spiro[7-oxa-2-azabicyclo[4.1.0]heptane-5,3'-piperidine]-1'-yl]-5-methoxy-3-pyridinyl]carbamate.
| Compound Name | prop-2-ynyl N-[6-[(5R,6S)-2-(4-hydroxycyclohexyl)spiro[7-oxa-2-azabicyclo[4.1.0]heptane-5,3'-piperidine]-1'-yl]-5-methoxy-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 143229756 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | prop-2-ynyl N-[6-[(5R,6S)-2-(4-hydroxycyclohexyl)spiro[7-oxa-2-azabicyclo[4.1.0]heptane-5,3'-piperidine]-1'-yl]-5-methoxy-3-pyridinyl]carbamate |
| SMILES | C#CCOC(=O)Nc1cnc(N2CCC[C@@]3(CCN(C4CCC(O)CC4)C4O[C@H]43)C2)c(OC)c1 |
| InChI | InChI=1S/C25H34N4O5/c1-3-13-33-24(31)27-17-14-20(32-2)22(26-15-17)28-11-4-9-25(16-28)10-12-29(23-21(25)34-23)18-5-7-19(30)8-6-18/h1,14-15,18-19,21,23,30H,4-13,16H2,2H3,(H,27,31)/t18?,19?,21-,23?,25-/m1/s1 |
| InChIKey | VRYCLTDXZKATBY-QCRIMWCCSA-N |
| XLogP | 2.59 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|