C24H35N3O4 — CID 76677787
ethyl N-[4-[2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-methylphenyl]carbamate (PubChem CID 76677787) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is ethyl N-[4-[2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-methylphenyl]carbamate.
| Compound Name | ethyl N-[4-[2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-methylphenyl]carbamate |
|---|---|
| PubChem CID | 76677787 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | ethyl N-[4-[2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-methylphenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(N2CCCC3(CCN(C4CCC(O)CC4)C3=O)C2)c(C)c1 |
| InChI | InChI=1S/C24H35N3O4/c1-3-31-23(30)25-18-5-10-21(17(2)15-18)26-13-4-11-24(16-26)12-14-27(22(24)29)19-6-8-20(28)9-7-19/h5,10,15,19-20,28H,3-4,6-9,11-14,16H2,1-2H3,(H,25,30) |
| InChIKey | BCDGEJLPCJCQDJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|