C23H32FN3O4 — CID 66722196
ethyl-[3-fluoro-4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]carbamic acid (PubChem CID 66722196) has the molecular formula C23H32FN3O4 and a molecular weight of 433.52 g/mol. Its IUPAC name is ethyl-[3-fluoro-4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]carbamic acid.
| Compound Name | ethyl-[3-fluoro-4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 66722196 |
| Molecular Formula | C23H32FN3O4 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | ethyl-[3-fluoro-4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]carbamic acid |
| SMILES | CCN(C(=O)O)c1ccc(N2CCC[C@]3(CCN(C4CCC(O)CC4)C3=O)C2)c(F)c1 |
| InChI | InChI=1S/C23H32FN3O4/c1-2-26(22(30)31)17-6-9-20(19(24)14-17)25-12-3-10-23(15-25)11-13-27(21(23)29)16-4-7-18(28)8-5-16/h6,9,14,16,18,28H,2-5,7-8,10-13,15H2,1H3,(H,30,31)/t16?,18?,23-/m0/s1 |
| InChIKey | MXLVTEDMQUESMD-KOBHVQJXSA-N |
| XLogP | 3.45 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|